Ethyl 2-Amino-5-Oxazolecarboxylate - Names and Identifiers
Name | 2-Amino-Oxazole-5-Carboxylic Acid Ethyl Ester
|
Synonyms | Ethyl 2-Aminooxazole-5-Carboxylate Ethyl 2-Amino-5-Oxazolecarboxylate ETHYL 2-AMINOOXAZOLE-5-CARBOXYLATE ETHYL 2-AMINO-5-OXAZOLECARBOXYLATE 5-(Ethoxycarbonyl)-1,3-oxazol-2-amine ETHYL 2-AMINO-1,3-OXAZOLE-5-CARBOXYLATE Ethyl 2-Amino-1,3-Oxazole-5-Carboxylate 2-Amino-Oxazole-5-Carboxylic Acid Ethyl Ester 2-AMINO-OXAZOLE-5-CARBOXYLIC ACID ETHYL ESTER 5-Oxazolecarboxylicacid, 2-aMino-, ethyl ester 5-(Ethoxycarbonyl)-1,3-oxazol-2-amine, 2-Amino-5-(ethoxycarbonyl)-1,3-oxazole
|
CAS | 113853-16-0
|
InChI | InChI=1/C6H8N2O3/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3,(H2,7,8) |
Ethyl 2-Amino-5-Oxazolecarboxylate - Physico-chemical Properties
Molecular Formula | C6H8N2O3
|
Molar Mass | 156.14 |
Density | 1.278±0.06 g/cm3(Predicted) |
Melting Point | 151-153 |
Boling Point | 282.9±32.0 °C(Predicted) |
Flash Point | 124.9°C |
Vapor Presure | 0.00326mmHg at 25°C |
Appearance | Solid |
pKa | 3.39±0.10(Predicted) |
Storage Condition | under inert gas (nitrogen or Argon) at 2–8 °C |
Refractive Index | 1.522 |
Ethyl 2-Amino-5-Oxazolecarboxylate - Risk and Safety
Hazard Symbols | Xi - Irritant
|
Hazard Note | Irritant |
Ethyl 2-Amino-5-Oxazolecarboxylate - Introduction
Ethyl 2-aminooxazole-5-carboxylate (abbreviation: AzaX) is an organic compound. Its chemical formula is C6H7N3O3.
Nature:
1. Appearance: AzaX is white or white-like crystal, or white or white-like crystal powder.
2. Solubility: AzaX has low solubility in water, but has good solubility in organic solvents (such as methanol, ethanol, acetone, etc.).
Use:
1. Chemical synthesis: AzaX can be used as a raw material or intermediate in organic synthesis for the synthesis of other compounds.
2. medicinal chemistry: AzaX can be used as a part of the drug molecule, with potential drug activity, for the development of new drugs.
3. Photoelectric materials: AzaX can be used to prepare photoelectric materials, such as organic light-emitting diodes (OLED), organic field effect transistors (OFET), etc.
Method:
There are many synthetic methods of AzaX, and a common synthetic method is obtained by the reaction of 2-aminooxazole with ethyl chloroacetate.
Safety Information:
1. Long-term exposure to AzaX may be harmful to human health, and protective measures should be taken.
2. Avoid contact with skin or eyes. If contact occurs, rinse immediately with plenty of water.
3. Wear protective gloves and goggles when using or handling AzaX.
Last Update:2024-04-09 02:00:41